C16H23IN3O15P3S2 — CID 155048737
[[5-[5-[3-(carboniodidoylamino)prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-3-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 155048737) has the molecular formula C16H23IN3O15P3S2 and a molecular weight of 781.33 g/mol. Its IUPAC name is [[5-[5-[3-(carboniodidoylamino)prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-3-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-[5-[3-(carboniodidoylamino)prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-3-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 155048737 |
| Molecular Formula | C16H23IN3O15P3S2 |
| Molecular Weight | 781.33 g/mol |
| Exact Mass | 780.88 |
| IUPAC Name | [[5-[5-[3-(carboniodidoylamino)prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-3-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CSS[C@@H](C)OC1CC(n2cc(C#CCNC(=O)I)c(=O)[nH]c2=O)OC1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C16H23IN3O15P3S2/c1-9(40-39-2)32-11-6-13(20-7-10(14(21)19-16(20)23)4-3-5-18-15(17)22)33-12(11)8-31-37(27,28)35-38(29,30)34-36(24,25)26/h7,9,11-13H,5-6,8H2,1-2H3,(H,18,22)(H,27,28)(H,29,30)(H,19,21,23)(H2,24,25,26)/t9-,11?,12?,13?/m0/s1 |
| InChIKey | XSCZWKWJCDUZEZ-KODGCSJUSA-N |
| XLogP | 1.41 |
| TPSA | 262.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|