C18H27O12P3S2 — CID 174000331
[[(2R,3R,5R)-5-(cyclodecapentaenyl)-3-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174000331) has the molecular formula C18H27O12P3S2 and a molecular weight of 592.46 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-(cyclodecapentaenyl)-3-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-(cyclodecapentaenyl)-3-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174000331 |
| Molecular Formula | C18H27O12P3S2 |
| Molecular Weight | 592.46 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | [[(2R,3R,5R)-5-(cyclodecapentaenyl)-3-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CSS[C@@H](C)O[C@@H]1C[C@H](c2ccccccccc2)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C18H27O12P3S2/c1-14(35-34-2)27-17-12-16(15-10-8-6-4-3-5-7-9-11-15)28-18(17)13-26-32(22,23)30-33(24,25)29-31(19,20)21/h3-11,14,16-18H,12-13H2,1-2H3,(H,22,23)(H,24,25)(H2,19,20,21)/b4-3-,5-3-,6-4-,7-5+,8-6+,9-7+,10-8+,11-9-,15-10+,15-11+/t14-,16+,17+,18+/m0/s1 |
| InChIKey | AKBZNAPVUFHINY-ZCQFEIHLSA-N |
| XLogP | 4.73 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|