C11H25O12P3 — CID 164978112
[hydroxy-[[(2R,3R,5S)-3-methoxy-5-(3-methylbutyl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 164978112) has the molecular formula C11H25O12P3 and a molecular weight of 442.23 g/mol. Its IUPAC name is [hydroxy-[[(2R,3R,5S)-3-methoxy-5-(3-methylbutyl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,3R,5S)-3-methoxy-5-(3-methylbutyl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 164978112 |
| Molecular Formula | C11H25O12P3 |
| Molecular Weight | 442.23 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | [hydroxy-[[(2R,3R,5S)-3-methoxy-5-(3-methylbutyl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | CO[C@@H]1C[C@H](CCC(C)C)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H25O12P3/c1-8(2)4-5-9-6-10(19-3)11(21-9)7-20-25(15,16)23-26(17,18)22-24(12,13)14/h8-11H,4-7H2,1-3H3,(H,15,16)(H,17,18)(H2,12,13,14)/t9-,10+,11+/m0/s1 |
| InChIKey | MAMWOVKFKHRYHW-HBNTYKKESA-N |
| XLogP | 1.94 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|