C7H17O12P3 — CID 157081438
[[(2R,5S)-5-ethyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 157081438) has the molecular formula C7H17O12P3 and a molecular weight of 386.12 g/mol. Its IUPAC name is [[(2R,5S)-5-ethyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5S)-5-ethyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 157081438 |
| Molecular Formula | C7H17O12P3 |
| Molecular Weight | 386.12 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | [[(2R,5S)-5-ethyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC[C@H]1CC(O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C7H17O12P3/c1-2-5-3-6(8)7(17-5)4-16-21(12,13)19-22(14,15)18-20(9,10)11/h5-8H,2-4H2,1H3,(H,12,13)(H,14,15)(H2,9,10,11)/t5-,6?,7+/m0/s1 |
| InChIKey | CSHBHCNBADKTRH-REJBHVJUSA-N |
| XLogP | 0.26 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.12 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|