C12H19N4O12P3 — CID 88982690
[[5-(6-ethylpurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 88982690) has the molecular formula C12H19N4O12P3 and a molecular weight of 504.22 g/mol. Its IUPAC name is [[5-(6-ethylpurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(6-ethylpurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 88982690 |
| Molecular Formula | C12H19N4O12P3 |
| Molecular Weight | 504.22 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | [[5-(6-ethylpurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCc1ncnc2c1ncn2C1CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C12H19N4O12P3/c1-2-7-11-12(14-5-13-7)16(6-15-11)10-3-8(17)9(26-10)4-25-30(21,22)28-31(23,24)27-29(18,19)20/h5-6,8-10,17H,2-4H2,1H3,(H,21,22)(H,23,24)(H2,18,19,20) |
| InChIKey | GQURCSIMAMKMTB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 232.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|