C12H20N5O13P3 — CID 85319660
[[5-(2-amino-6-ethoxypurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 85319660) has the molecular formula C12H20N5O13P3 and a molecular weight of 535.24 g/mol. Its IUPAC name is [[5-(2-amino-6-ethoxypurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(2-amino-6-ethoxypurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 85319660 |
| Molecular Formula | C12H20N5O13P3 |
| Molecular Weight | 535.24 g/mol |
| Exact Mass | 535.03 |
| IUPAC Name | [[5-(2-amino-6-ethoxypurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCOc1nc(N)nc2c1ncn2C1CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C12H20N5O13P3/c1-2-26-11-9-10(15-12(13)16-11)17(5-14-9)8-3-6(18)7(28-8)4-27-32(22,23)30-33(24,25)29-31(19,20)21/h5-8,18H,2-4H2,1H3,(H,22,23)(H,24,25)(H2,13,15,16)(H2,19,20,21) |
| InChIKey | FFBPESAOMMHUCK-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 268.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|