C11H17ClN5O11P3 — CID 123293097
[[5-(2-amino-6-chloropurin-9-yl)-3-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123293097) has the molecular formula C11H17ClN5O11P3 and a molecular weight of 523.66 g/mol. Its IUPAC name is [[5-(2-amino-6-chloropurin-9-yl)-3-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(2-amino-6-chloropurin-9-yl)-3-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123293097 |
| Molecular Formula | C11H17ClN5O11P3 |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 522.98 |
| IUPAC Name | [[5-(2-amino-6-chloropurin-9-yl)-3-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1CC(n2cnc3c(Cl)nc(N)nc32)OC1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H17ClN5O11P3/c1-5-2-7(17-4-14-8-9(12)15-11(13)16-10(8)17)26-6(5)3-25-30(21,22)28-31(23,24)27-29(18,19)20/h4-7H,2-3H2,1H3,(H,21,22)(H,23,24)(H2,13,15,16)(H2,18,19,20) |
| InChIKey | MSTZEPOVHCHRCP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 238.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|