C6H15BO12P3 — CID 59084172
CID 59084172 (PubChem CID 59084172) has the molecular formula C6H15BO12P3 and a molecular weight of 383.91 g/mol.
| Compound Name | CID 59084172 |
|---|---|
| PubChem CID | 59084172 |
| Molecular Formula | C6H15BO12P3 |
| Molecular Weight | 383.91 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | — |
| SMILES | [2H]C[B][C@H]1C[C@@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C6H15BO12P3/c1-7-6-2-4(8)5(17-6)3-16-21(12,13)19-22(14,15)18-20(9,10)11/h4-6,8H,2-3H2,1H3,(H,12,13)(H,14,15)(H2,9,10,11)/t4-,5-,6-/m1/s1/i1D |
| InChIKey | ABFJLIPNCZVENE-OYWVDAAISA-N |
| XLogP | -0.44 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.91 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|