C16H37N3O21P6 — CID 140846449
[10-azidodecoxy(hydroxy)phosphoryl] [hydroxy-[hydroxy-[hydroxy-[hydroxy-[[(2S,5R)-3-hydroxy-5-methyloxolan-2-yl]methoxy]phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyphosphoryl] hydrogen phosphate (PubChem CID 140846449) has the molecular formula C16H37N3O21P6 and a molecular weight of 793.32 g/mol. Its IUPAC name is [10-azidodecoxy(hydroxy)phosphoryl] [hydroxy-[hydroxy-[hydroxy-[hydroxy-[[(2S,5R)-3-hydroxy-5-methyloxolan-2-yl]methoxy]phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyphosphoryl] hydrogen phosphate.
| Compound Name | [10-azidodecoxy(hydroxy)phosphoryl] [hydroxy-[hydroxy-[hydroxy-[hydroxy-[[(2S,5R)-3-hydroxy-5-methyloxolan-2-yl]methoxy]phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 140846449 |
| Molecular Formula | C16H37N3O21P6 |
| Molecular Weight | 793.32 g/mol |
| Exact Mass | 793.03 |
| IUPAC Name | [10-azidodecoxy(hydroxy)phosphoryl] [hydroxy-[hydroxy-[hydroxy-[hydroxy-[[(2S,5R)-3-hydroxy-5-methyloxolan-2-yl]methoxy]phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyphosphoryl] hydrogen phosphate |
| SMILES | C[C@@H]1CC(O)[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCCCCCCCCCCN=[N+]=[N-])O1 |
| InChI | InChI=1S/C16H37N3O21P6/c1-14-12-15(20)16(35-14)13-34-42(23,24)37-44(27,28)39-46(31,32)40-45(29,30)38-43(25,26)36-41(21,22)33-11-9-7-5-3-2-4-6-8-10-18-19-17/h14-16,20H,2-13H2,1H3,(H,21,22)(H,23,24)(H,25,26)(H,27,28)(H,29,30)(H,31,32)/t14-,15?,16+/m1/s1 |
| InChIKey | RRFQRYILVODJQY-TUOGLVOQSA-N |
| XLogP | 4.67 |
| TPSA | 366.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|