C14H30O9P2 — CID 163761070
[(2R,5S)-2-[[butoxy(hydroxy)phosphoryl]oxymethyl]-5-methyloxolan-3-yl] butyl hydrogen phosphate (PubChem CID 163761070) has the molecular formula C14H30O9P2 and a molecular weight of 404.33 g/mol. Its IUPAC name is [(2R,5S)-2-[[butoxy(hydroxy)phosphoryl]oxymethyl]-5-methyloxolan-3-yl] butyl hydrogen phosphate.
| Compound Name | [(2R,5S)-2-[[butoxy(hydroxy)phosphoryl]oxymethyl]-5-methyloxolan-3-yl] butyl hydrogen phosphate |
|---|---|
| PubChem CID | 163761070 |
| Molecular Formula | C14H30O9P2 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [(2R,5S)-2-[[butoxy(hydroxy)phosphoryl]oxymethyl]-5-methyloxolan-3-yl] butyl hydrogen phosphate |
| SMILES | CCCCOP(=O)(O)OC[C@H]1O[C@@H](C)CC1OP(=O)(O)OCCCC |
| InChI | InChI=1S/C14H30O9P2/c1-4-6-8-19-24(15,16)21-11-14-13(10-12(3)22-14)23-25(17,18)20-9-7-5-2/h12-14H,4-11H2,1-3H3,(H,15,16)(H,17,18)/t12-,13?,14+/m0/s1 |
| InChIKey | LYFJZERYIXMODO-SMEJFCCLSA-N |
| XLogP | 3.40 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|