C17H35O13P3 — CID 157280642
[(2R,3S,5S)-3-[[(2R,3S,5S)-3-[ethoxy(hydroxy)phosphoryl]oxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-methyloxolan-2-yl]methoxy-propan-2-ylphosphinic acid (PubChem CID 157280642) has the molecular formula C17H35O13P3 and a molecular weight of 540.38 g/mol. Its IUPAC name is [(2R,3S,5S)-3-[[(2R,3S,5S)-3-[ethoxy(hydroxy)phosphoryl]oxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-methyloxolan-2-yl]methoxy-propan-2-ylphosphinic acid.
| Compound Name | [(2R,3S,5S)-3-[[(2R,3S,5S)-3-[ethoxy(hydroxy)phosphoryl]oxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-methyloxolan-2-yl]methoxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 157280642 |
| Molecular Formula | C17H35O13P3 |
| Molecular Weight | 540.38 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | [(2R,3S,5S)-3-[[(2R,3S,5S)-3-[ethoxy(hydroxy)phosphoryl]oxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-methyloxolan-2-yl]methoxy-propan-2-ylphosphinic acid |
| SMILES | CCOP(=O)(O)O[C@H]1C[C@H](C)O[C@@H]1COP(=O)(O)O[C@H]1C[C@H](C)O[C@@H]1COP(=O)(O)C(C)C |
| InChI | InChI=1S/C17H35O13P3/c1-6-24-32(20,21)29-15-8-13(5)28-17(15)10-26-33(22,23)30-14-7-12(4)27-16(14)9-25-31(18,19)11(2)3/h11-17H,6-10H2,1-5H3,(H,18,19)(H,20,21)(H,22,23)/t12-,13-,14-,15-,16+,17+/m0/s1 |
| InChIKey | GJLJQQXLYFYXSZ-NQLMQOPMSA-N |
| XLogP | 2.98 |
| TPSA | 176.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|