C11H21O6P — CID 22965006
[2-(1-hydroxyethenyl)-5-methyloxolan-3-yl] 2-methylpropyl hydrogen phosphate (PubChem CID 22965006) has the molecular formula C11H21O6P and a molecular weight of 280.26 g/mol. Its IUPAC name is [2-(1-hydroxyethenyl)-5-methyloxolan-3-yl] 2-methylpropyl hydrogen phosphate.
| Compound Name | [2-(1-hydroxyethenyl)-5-methyloxolan-3-yl] 2-methylpropyl hydrogen phosphate |
|---|---|
| PubChem CID | 22965006 |
| Molecular Formula | C11H21O6P |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [2-(1-hydroxyethenyl)-5-methyloxolan-3-yl] 2-methylpropyl hydrogen phosphate |
| SMILES | C=C(O)C1OC(C)CC1OP(=O)(O)OCC(C)C |
| InChI | InChI=1S/C11H21O6P/c1-7(2)6-15-18(13,14)17-10-5-8(3)16-11(10)9(4)12/h7-8,10-12H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | FLQGGCIZDGLWMK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|