C10H20NO9P — CID 91159955
2-nitrosobutyl (2,3,4,5-tetrahydroxycyclohexyl) hydrogen phosphate (PubChem CID 91159955) has the molecular formula C10H20NO9P and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-nitrosobutyl (2,3,4,5-tetrahydroxycyclohexyl) hydrogen phosphate.
| Compound Name | 2-nitrosobutyl (2,3,4,5-tetrahydroxycyclohexyl) hydrogen phosphate |
|---|---|
| PubChem CID | 91159955 |
| Molecular Formula | C10H20NO9P |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-nitrosobutyl (2,3,4,5-tetrahydroxycyclohexyl) hydrogen phosphate |
| SMILES | CCC(COP(=O)(O)OC1CC(O)C(O)C(O)C1O)N=O |
| InChI | InChI=1S/C10H20NO9P/c1-2-5(11-16)4-19-21(17,18)20-7-3-6(12)8(13)10(15)9(7)14/h5-10,12-15H,2-4H2,1H3,(H,17,18) |
| InChIKey | DELQCPKLIJEQPH-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 166.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|