C9H18NO11P — CID 102506300
(2S)-2-amino-3-[hydroxy-[(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropanoic acid (PubChem CID 102506300) has the molecular formula C9H18NO11P and a molecular weight of 347.21 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 102506300 |
| Molecular Formula | C9H18NO11P |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropanoic acid |
| SMILES | N[C@@H](COP(=O)(O)OC1[C@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C9H18NO11P/c10-2(9(16)17)1-20-22(18,19)21-8-6(14)4(12)3(11)5(13)7(8)15/h2-8,11-15H,1,10H2,(H,16,17)(H,18,19)/t2-,3?,4-,5+,6+,7+,8?/m0/s1 |
| InChIKey | DNOYQCBMYUPUNL-DQRYPGICSA-N |
| XLogP | -4.28 |
| TPSA | 220.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|