C12H23O14P — CID 101490616
[(2S,3S,5R,6S)-2,3,4,5,6-pentahydroxycyclohexyl] [(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate (PubChem CID 101490616) has the molecular formula C12H23O14P and a molecular weight of 423.27 g/mol. Its IUPAC name is [(2S,3S,5R,6S)-2,3,4,5,6-pentahydroxycyclohexyl] [(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate.
| Compound Name | [(2S,3S,5R,6S)-2,3,4,5,6-pentahydroxycyclohexyl] [(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 101490616 |
| Molecular Formula | C12H23O14P |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [(2S,3S,5R,6S)-2,3,4,5,6-pentahydroxycyclohexyl] [(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate |
| SMILES | O=P(O)(OC1[C@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O)O[13CH]1[C@@H](O)[C@H](O)C(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23O14P/c13-1-3(15)7(19)11(8(20)4(1)16)25-27(23,24)26-12-9(21)5(17)2(14)6(18)10(12)22/h1-22H,(H,23,24)/t1?,2?,3-,4+,5-,6+,7-,8-,9+,10+,11?,12?/i11+1/m0/s1 |
| InChIKey | FIIUDBCIQWHEHT-UGMREFPDSA-N |
| XLogP | -6.51 |
| TPSA | 258.06 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | -6.51 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|