C6H15O15P3 — CID 14389199
[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 14389199) has the molecular formula C6H15O15P3 and a molecular weight of 420.09 g/mol. Its IUPAC name is [hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 14389199 |
| Molecular Formula | C6H15O15P3 |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | [hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C6H15O15P3/c7-1-2(8)4(10)6(5(11)3(1)9)19-23(15,16)21-24(17,18)20-22(12,13)14/h1-11H,(H,15,16)(H,17,18)(H2,12,13,14) |
| InChIKey | ZJRLNLRWOYVAEB-UHFFFAOYSA-N |
| XLogP | -3.48 |
| TPSA | 260.97 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|