C6H15O12P3 — CID 91026686
[(3R,5S)-3,5-dihydroxycyclohexyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 91026686) has the molecular formula C6H15O12P3 and a molecular weight of 372.10 g/mol. Its IUPAC name is [(3R,5S)-3,5-dihydroxycyclohexyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(3R,5S)-3,5-dihydroxycyclohexyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 91026686 |
| Molecular Formula | C6H15O12P3 |
| Molecular Weight | 372.10 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | [(3R,5S)-3,5-dihydroxycyclohexyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC1C[C@@H](O)C[C@@H](O)C1 |
| InChI | InChI=1S/C6H15O12P3/c7-4-1-5(8)3-6(2-4)16-20(12,13)18-21(14,15)17-19(9,10)11/h4-8H,1-3H2,(H,12,13)(H,14,15)(H2,9,10,11)/t4-,5+,6? |
| InChIKey | RQXFIFYLLLHUCN-XEAPYIEGSA-N |
| XLogP | -0.40 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.10 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|