C6H18O24P6 — CID 53379839
[(1R,2R,3R,4R,5R,6S)-4,5-dihydroxy-2-[hydroxy(phosphonooxy)phosphoryl]oxy-3,6-diphosphonooxycyclohexyl] phosphono hydrogen phosphate (PubChem CID 53379839) has the molecular formula C6H18O24P6 and a molecular weight of 660.03 g/mol. Its IUPAC name is [(1R,2R,3R,4R,5R,6S)-4,5-dihydroxy-2-[hydroxy(phosphonooxy)phosphoryl]oxy-3,6-diphosphonooxycyclohexyl] phosphono hydrogen phosphate.
| Compound Name | [(1R,2R,3R,4R,5R,6S)-4,5-dihydroxy-2-[hydroxy(phosphonooxy)phosphoryl]oxy-3,6-diphosphonooxycyclohexyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 53379839 |
| Molecular Formula | C6H18O24P6 |
| Molecular Weight | 660.03 g/mol |
| Exact Mass | 659.86 |
| IUPAC Name | [(1R,2R,3R,4R,5R,6S)-4,5-dihydroxy-2-[hydroxy(phosphonooxy)phosphoryl]oxy-3,6-diphosphonooxycyclohexyl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OC1[C@@H](OP(=O)(O)OP(=O)(O)O)[C@H](OP(=O)(O)OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H18O24P6/c7-1-2(8)4(26-32(12,13)14)6(28-36(23,24)30-34(18,19)20)5(3(1)25-31(9,10)11)27-35(21,22)29-33(15,16)17/h1-8H,(H,21,22)(H,23,24)(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)/t1-,2-,3-,4?,5-,6-/m1/s1 |
| InChIKey | JGEQJFFSPDCEPT-BVHOKVJESA-N |
| XLogP | -3.13 |
| TPSA | 400.56 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.03 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|