C6H21O24P7 — CID 87060873
(2,3,4,5,6-pentaphosphonooxycyclohexyl) dihydrogen phosphate;phosphane (PubChem CID 87060873) has the molecular formula C6H21O24P7 and a molecular weight of 694.03 g/mol. Its IUPAC name is (2,3,4,5,6-pentaphosphonooxycyclohexyl) dihydrogen phosphate;phosphane.
| Compound Name | (2,3,4,5,6-pentaphosphonooxycyclohexyl) dihydrogen phosphate;phosphane |
|---|---|
| PubChem CID | 87060873 |
| Molecular Formula | C6H21O24P7 |
| Molecular Weight | 694.03 g/mol |
| Exact Mass | 693.86 |
| IUPAC Name | (2,3,4,5,6-pentaphosphonooxycyclohexyl) dihydrogen phosphate;phosphane |
| SMILES | O=P(O)(O)OC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O.P |
| InChI | InChI=1S/C6H18O24P6.H3P/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15;/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24);1H3 |
| InChIKey | SFIHSGLPRNAHQB-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 400.56 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.03 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|