C6H18KMgO24P6 — CID 71308444
Phytic acid dimagnesium tetrapotassium salt, ~95% (PubChem CID 71308444) has the molecular formula C6H18KMgO24P6 and a molecular weight of 723.43 g/mol.
| Compound Name | Phytic acid dimagnesium tetrapotassium salt, ~95% |
|---|---|
| PubChem CID | 71308444 |
| Molecular Formula | C6H18KMgO24P6 |
| Molecular Weight | 723.43 g/mol |
| Exact Mass | 722.81 |
| IUPAC Name | — |
| SMILES | O=P(O)(O)OC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O.[K].[Mg] |
| InChI | InChI=1S/C6H18O24P6.K.Mg/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15;;/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24);; |
| InChIKey | FJHDFGCTUYABEE-UHFFFAOYSA-N |
| XLogP | -3.89 |
| TPSA | 400.56 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.43 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|