C6H19O27P7 — CID 53379639
[(1S,2R,3R,4S,5R,6S)-2,3-dihydroxy-5,6-bis[[hydroxy(phosphonooxy)phosphoryl]oxy]-4-phosphonooxycyclohexyl] phosphono hydrogen phosphate (PubChem CID 53379639) has the molecular formula C6H19O27P7 and a molecular weight of 740.01 g/mol. Its IUPAC name is [(1S,2R,3R,4S,5R,6S)-2,3-dihydroxy-5,6-bis[[hydroxy(phosphonooxy)phosphoryl]oxy]-4-phosphonooxycyclohexyl] phosphono hydrogen phosphate.
| Compound Name | [(1S,2R,3R,4S,5R,6S)-2,3-dihydroxy-5,6-bis[[hydroxy(phosphonooxy)phosphoryl]oxy]-4-phosphonooxycyclohexyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 53379639 |
| Molecular Formula | C6H19O27P7 |
| Molecular Weight | 740.01 g/mol |
| Exact Mass | 739.83 |
| IUPAC Name | [(1S,2R,3R,4S,5R,6S)-2,3-dihydroxy-5,6-bis[[hydroxy(phosphonooxy)phosphoryl]oxy]-4-phosphonooxycyclohexyl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OC1[C@@H](OP(=O)(O)OP(=O)(O)O)[C@@H](OP(=O)(O)OP(=O)(O)O)[C@@H](OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H19O27P7/c7-1-2(8)4(28-38(21,22)31-35(12,13)14)6(30-40(25,26)33-37(18,19)20)5(3(1)27-34(9,10)11)29-39(23,24)32-36(15,16)17/h1-8H,(H,21,22)(H,23,24)(H,25,26)(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)/t1-,2-,3?,4+,5-,6+/m1/s1 |
| InChIKey | MSWRRLHALNLEIK-KENVZAIASA-N |
| XLogP | -3.02 |
| TPSA | 447.09 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.01 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|