C6H10O24P6-8 — CID 122389780
[(1S,2R,3S,4R,5R,6S)-2-hydroxy-4-[hydroxy(phosphonooxy)phosphoryl]oxy-3,5,6-triphosphonatooxycyclohexyl] phosphate (PubChem CID 122389780) has the molecular formula C6H10O24P6-8 and a molecular weight of 651.97 g/mol. Its IUPAC name is [(1S,2R,3S,4R,5R,6S)-2-hydroxy-4-[hydroxy(phosphonooxy)phosphoryl]oxy-3,5,6-triphosphonatooxycyclohexyl] phosphate.
| Compound Name | [(1S,2R,3S,4R,5R,6S)-2-hydroxy-4-[hydroxy(phosphonooxy)phosphoryl]oxy-3,5,6-triphosphonatooxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 122389780 |
| Molecular Formula | C6H10O24P6-8 |
| Molecular Weight | 651.97 g/mol |
| Exact Mass | 651.80 |
| IUPAC Name | [(1S,2R,3S,4R,5R,6S)-2-hydroxy-4-[hydroxy(phosphonooxy)phosphoryl]oxy-3,5,6-triphosphonatooxycyclohexyl] phosphate |
| SMILES | O=P([O-])([O-])O[C@@H]1[C@@H](OP(=O)([O-])[O-])[C@@H](OP(=O)([O-])[O-])[C@@H](O)[C@H](OP(=O)([O-])[O-])[C@H]1OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C6H18O24P6/c7-1-2(25-31(8,9)10)4(27-33(14,15)16)6(28-34(17,18)19)5(3(1)26-32(11,12)13)29-36(23,24)30-35(20,21)22/h1-7H,(H,23,24)(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)(H2,17,18,19)(H2,20,21,22)/p-8/t1-,2+,3+,4+,5-,6-/m1/s1 |
| InChIKey | DKLABXZLIOMPIM-HMEVWOALSA-F |
| XLogP | -8.19 |
| TPSA | 423.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.97 |
| LogP ≤ 5 | -8.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|