C6H11O18P4-5 — CID 75660880
[3,4-dihydroxy-2,5,6-tris[[hydroxy(oxido)phosphoryl]oxy]cyclohexyl] phosphate (PubChem CID 75660880) has the molecular formula C6H11O18P4-5 and a molecular weight of 495.03 g/mol. Its IUPAC name is [3,4-dihydroxy-2,5,6-tris[[hydroxy(oxido)phosphoryl]oxy]cyclohexyl] phosphate.
| Compound Name | [3,4-dihydroxy-2,5,6-tris[[hydroxy(oxido)phosphoryl]oxy]cyclohexyl] phosphate |
|---|---|
| PubChem CID | 75660880 |
| Molecular Formula | C6H11O18P4-5 |
| Molecular Weight | 495.03 g/mol |
| Exact Mass | 494.89 |
| IUPAC Name | [3,4-dihydroxy-2,5,6-tris[[hydroxy(oxido)phosphoryl]oxy]cyclohexyl] phosphate |
| SMILES | O=P([O-])([O-])OC1C(OP(=O)([O-])O)C(O)C(O)C(OP(=O)([O-])O)C1OP(=O)([O-])O |
| InChI | InChI=1S/C6H16O18P4/c7-1-2(8)4(22-26(12,13)14)6(24-28(18,19)20)5(23-27(15,16)17)3(1)21-25(9,10)11/h1-8H,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)/p-5 |
| InChIKey | MRVYFOANPDTYBY-UHFFFAOYSA-I |
| XLogP | -6.53 |
| TPSA | 321.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.03 |
| LogP ≤ 5 | -6.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|