C6H10O12P2-4 — CID 25203530
[(2R,3S,5R,6R)-2,3,5,6-tetrahydroxy-4-phosphonatooxycyclohexyl] phosphate (PubChem CID 25203530) has the molecular formula C6H10O12P2-4 and a molecular weight of 336.08 g/mol. Its IUPAC name is [(2R,3S,5R,6R)-2,3,5,6-tetrahydroxy-4-phosphonatooxycyclohexyl] phosphate.
| Compound Name | [(2R,3S,5R,6R)-2,3,5,6-tetrahydroxy-4-phosphonatooxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 25203530 |
| Molecular Formula | C6H10O12P2-4 |
| Molecular Weight | 336.08 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | [(2R,3S,5R,6R)-2,3,5,6-tetrahydroxy-4-phosphonatooxycyclohexyl] phosphate |
| SMILES | O=P([O-])([O-])OC1[C@@H](O)[C@@H](O)C(OP(=O)([O-])[O-])[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H14O12P2/c7-1-2(8)6(18-20(14,15)16)4(10)3(9)5(1)17-19(11,12)13/h1-10H,(H2,11,12,13)(H2,14,15,16)/p-4/t1-,2-,3-,4+,5?,6?/m1/s1 |
| InChIKey | PELZSPZCXGTUMR-MBEOBJKWSA-J |
| XLogP | -6.13 |
| TPSA | 225.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.08 |
| LogP ≤ 5 | -6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|