C6H12O9P- — CID 25203839
[(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate (PubChem CID 25203839) has the molecular formula C6H12O9P- and a molecular weight of 259.13 g/mol. Its IUPAC name is [(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate.
| Compound Name | [(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 25203839 |
| Molecular Formula | C6H12O9P- |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | [(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate |
| SMILES | O=P([O-])(O)OC1[C@@H](O)[C@H](O)C(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13O9P/c7-1-2(8)4(10)6(5(11)3(1)9)15-16(12,13)14/h1-11H,(H2,12,13,14)/p-1/t1?,2-,3+,4-,5-,6?/m0/s1 |
| InChIKey | INAPMGSXUVUWAF-LXOASSSBSA-M |
| XLogP | -4.35 |
| TPSA | 170.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|