C6H7CuO24P6-10 — CID 154586091
copper(1+);[(1S,2R,4R,5R)-3-[hydroxy(oxido)phosphoryl]oxy-2,4,5,6-tetraphosphonatooxycyclohexyl] phosphate (PubChem CID 154586091) has the molecular formula C6H7CuO24P6-10 and a molecular weight of 712.49 g/mol. Its IUPAC name is copper(1+);[(1S,2R,4R,5R)-3-[hydroxy(oxido)phosphoryl]oxy-2,4,5,6-tetraphosphonatooxycyclohexyl] phosphate.
| Compound Name | copper(1+);[(1S,2R,4R,5R)-3-[hydroxy(oxido)phosphoryl]oxy-2,4,5,6-tetraphosphonatooxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 154586091 |
| Molecular Formula | C6H7CuO24P6-10 |
| Molecular Weight | 712.49 g/mol |
| Exact Mass | 711.71 |
| IUPAC Name | copper(1+);[(1S,2R,4R,5R)-3-[hydroxy(oxido)phosphoryl]oxy-2,4,5,6-tetraphosphonatooxycyclohexyl] phosphate |
| SMILES | O=P([O-])([O-])OC1[C@@H](OP(=O)([O-])[O-])[C@@H](OP(=O)([O-])[O-])C(OP(=O)([O-])O)[C@H](OP(=O)([O-])[O-])[C@H]1OP(=O)([O-])[O-].[Cu+] |
| InChI | InChI=1S/C6H18O24P6.Cu/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15;/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24);/q;+1/p-11/t1-,2-,3?,4?,5-,6+;/m1./s1 |
| InChIKey | IXNLRUZLWWZAKR-NFJZTGFVSA-C |
| XLogP | -10.09 |
| TPSA | 431.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.49 |
| LogP ≤ 5 | -10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|