C6H13O23P6-3 — CID 58130190
[(1S,2R,3S,4R,5R,6R)-2,5-bis[[hydroxy(oxido)phosphoryl]oxy]-4-[hydroxy(oxo)phosphaniumyl]oxy-3,6-diphosphonooxycyclohexyl] phosphate (PubChem CID 58130190) has the molecular formula C6H13O23P6-3 and a molecular weight of 638.99 g/mol. Its IUPAC name is [(1S,2R,3S,4R,5R,6R)-2,5-bis[[hydroxy(oxido)phosphoryl]oxy]-4-[hydroxy(oxo)phosphaniumyl]oxy-3,6-diphosphonooxycyclohexyl] phosphate.
| Compound Name | [(1S,2R,3S,4R,5R,6R)-2,5-bis[[hydroxy(oxido)phosphoryl]oxy]-4-[hydroxy(oxo)phosphaniumyl]oxy-3,6-diphosphonooxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 58130190 |
| Molecular Formula | C6H13O23P6-3 |
| Molecular Weight | 638.99 g/mol |
| Exact Mass | 638.83 |
| IUPAC Name | [(1S,2R,3S,4R,5R,6R)-2,5-bis[[hydroxy(oxido)phosphoryl]oxy]-4-[hydroxy(oxo)phosphaniumyl]oxy-3,6-diphosphonooxycyclohexyl] phosphate |
| SMILES | O=[P+](O)O[C@@H]1[C@@H](OP(=O)([O-])O)[C@H](OP(=O)(O)O)[C@@H](OP(=O)([O-])[O-])[C@@H](OP(=O)([O-])O)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C6H16O23P6/c7-30(8)24-1-2(25-31(9,10)11)4(27-33(15,16)17)6(29-35(21,22)23)5(28-34(18,19)20)3(1)26-32(12,13)14/h1-6H,(H10-,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23)/p-3/t1-,2-,3+,4-,5-,6-/m0/s1 |
| InChIKey | AUJUKRFCIPWZCF-PTQMNWPWSA-K |
| XLogP | -5.10 |
| TPSA | 391.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.99 |
| LogP ≤ 5 | -5.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|