C6H9O15P3-6 — CID 23246906
[(1R,2S,3S,4S,5S,6R)-2,3,5-trihydroxy-4,6-diphosphonatooxycyclohexyl] phosphate (PubChem CID 23246906) has the molecular formula C6H9O15P3-6 and a molecular weight of 414.05 g/mol. Its IUPAC name is [(1R,2S,3S,4S,5S,6R)-2,3,5-trihydroxy-4,6-diphosphonatooxycyclohexyl] phosphate.
| Compound Name | [(1R,2S,3S,4S,5S,6R)-2,3,5-trihydroxy-4,6-diphosphonatooxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 23246906 |
| Molecular Formula | C6H9O15P3-6 |
| Molecular Weight | 414.05 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | [(1R,2S,3S,4S,5S,6R)-2,3,5-trihydroxy-4,6-diphosphonatooxycyclohexyl] phosphate |
| SMILES | O=P([O-])([O-])O[C@H]1[C@@H](O)[C@H](O)[C@@H](OP(=O)([O-])[O-])[C@H](OP(=O)([O-])[O-])[C@H]1O |
| InChI | InChI=1S/C6H15O15P3/c7-1-2(8)5(20-23(13,14)15)6(21-24(16,17)18)3(9)4(1)19-22(10,11)12/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/p-6/t1-,2-,3-,4-,5+,6+/m0/s1 |
| InChIKey | MMWCIQZXVOZEGG-LKPKBOIGSA-H |
| XLogP | -7.28 |
| TPSA | 277.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.05 |
| LogP ≤ 5 | -7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|