C6H16O18P4 — CID 87791385
phosphono [(1R,2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-[hydroxy(phosphonooxy)phosphoryl]oxycyclohexyl] hydrogen phosphate (PubChem CID 87791385) has the molecular formula C6H16O18P4 and a molecular weight of 500.07 g/mol. Its IUPAC name is phosphono [(1R,2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-[hydroxy(phosphonooxy)phosphoryl]oxycyclohexyl] hydrogen phosphate.
| Compound Name | phosphono [(1R,2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-[hydroxy(phosphonooxy)phosphoryl]oxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 87791385 |
| Molecular Formula | C6H16O18P4 |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 499.93 |
| IUPAC Name | phosphono [(1R,2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-[hydroxy(phosphonooxy)phosphoryl]oxycyclohexyl] hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)O[C@@H]1[C@H](O)[C@@H](O)[C@@H](O)C(O)[C@H]1OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C6H16O18P4/c7-1-2(8)4(10)6(22-28(19,20)24-26(14,15)16)5(3(1)9)21-27(17,18)23-25(11,12)13/h1-10H,(H,17,18)(H,19,20)(H2,11,12,13)(H2,14,15,16)/t1-,2+,3+,4?,5+,6+/m0/s1 |
| InChIKey | LOGUMPVGZMNBBA-IFFHDVEOSA-N |
| XLogP | -3.37 |
| TPSA | 307.50 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|