C8H18O10P2 — CID 23568153
(2,5-dihydroxy-3,4-dimethyl-6-phosphonooxycyclohexyl) dihydrogen phosphate (PubChem CID 23568153) has the molecular formula C8H18O10P2 and a molecular weight of 336.17 g/mol. Its IUPAC name is (2,5-dihydroxy-3,4-dimethyl-6-phosphonooxycyclohexyl) dihydrogen phosphate.
| Compound Name | (2,5-dihydroxy-3,4-dimethyl-6-phosphonooxycyclohexyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 23568153 |
| Molecular Formula | C8H18O10P2 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (2,5-dihydroxy-3,4-dimethyl-6-phosphonooxycyclohexyl) dihydrogen phosphate |
| SMILES | CC1C(C)C(O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1O |
| InChI | InChI=1S/C8H18O10P2/c1-3-4(2)6(10)8(18-20(14,15)16)7(5(3)9)17-19(11,12)13/h3-10H,1-2H3,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | ZPZFDSSGMGDUFH-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|