C6H13O8P — CID 15886560
[(2S,3R,5S,6S)-2,3,5,6-tetrahydroxycyclohexyl] dihydrogen phosphate (PubChem CID 15886560) has the molecular formula C6H13O8P and a molecular weight of 244.14 g/mol. Its IUPAC name is [(2S,3R,5S,6S)-2,3,5,6-tetrahydroxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(2S,3R,5S,6S)-2,3,5,6-tetrahydroxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 15886560 |
| Molecular Formula | C6H13O8P |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | [(2S,3R,5S,6S)-2,3,5,6-tetrahydroxycyclohexyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC1[C@@H](O)[C@H](O)C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13O8P/c7-2-1-3(8)5(10)6(4(2)9)14-15(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3+,4-,5-,6?/m0/s1 |
| InChIKey | QSOXMPJYLQIUDI-QRXFDPRISA-N |
| XLogP | -2.69 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|