C7H17O14P3 — CID 18659642
methyl-[(1S,2S,3S,4S,5R,6S)-2,4,5-trihydroxy-3,6-diphosphonooxycyclohexyl]oxyphosphinic acid (PubChem CID 18659642) has the molecular formula C7H17O14P3 and a molecular weight of 418.12 g/mol. Its IUPAC name is methyl-[(1S,2S,3S,4S,5R,6S)-2,4,5-trihydroxy-3,6-diphosphonooxycyclohexyl]oxyphosphinic acid.
| Compound Name | methyl-[(1S,2S,3S,4S,5R,6S)-2,4,5-trihydroxy-3,6-diphosphonooxycyclohexyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 18659642 |
| Molecular Formula | C7H17O14P3 |
| Molecular Weight | 418.12 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | methyl-[(1S,2S,3S,4S,5R,6S)-2,4,5-trihydroxy-3,6-diphosphonooxycyclohexyl]oxyphosphinic acid |
| SMILES | CP(=O)(O)O[C@H]1[C@H](O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C7H17O14P3/c1-22(11,12)19-7-4(10)5(20-23(13,14)15)2(8)3(9)6(7)21-24(16,17)18/h2-10H,1H3,(H,11,12)(H2,13,14,15)(H2,16,17,18)/t2-,3+,4+,5-,6-,7-/m0/s1 |
| InChIKey | RZDMMRYIDHLDCU-ARYBSUEZSA-N |
| XLogP | -2.76 |
| TPSA | 240.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.12 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|