C9H19O17P3 — CID 4634718
(3-hydroxy-2-oxopropyl) (2,3,6-trihydroxy-4,5-diphosphonooxycyclohexyl) hydrogen phosphate (PubChem CID 4634718) has the molecular formula C9H19O17P3 and a molecular weight of 492.16 g/mol. Its IUPAC name is (3-hydroxy-2-oxopropyl) (2,3,6-trihydroxy-4,5-diphosphonooxycyclohexyl) hydrogen phosphate.
| Compound Name | (3-hydroxy-2-oxopropyl) (2,3,6-trihydroxy-4,5-diphosphonooxycyclohexyl) hydrogen phosphate |
|---|---|
| PubChem CID | 4634718 |
| Molecular Formula | C9H19O17P3 |
| Molecular Weight | 492.16 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | (3-hydroxy-2-oxopropyl) (2,3,6-trihydroxy-4,5-diphosphonooxycyclohexyl) hydrogen phosphate |
| SMILES | O=C(CO)COP(=O)(O)OC1C(O)C(O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1O |
| InChI | InChI=1S/C9H19O17P3/c10-1-3(11)2-23-29(21,22)26-7-4(12)5(13)8(24-27(15,16)17)9(6(7)14)25-28(18,19)20/h4-10,12-14H,1-2H2,(H,21,22)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | JBQPYAMQMBKZDT-UHFFFAOYSA-N |
| XLogP | -3.90 |
| TPSA | 287.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.16 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|