C11H21O19P3 — CID 135852760
(2S)-2-[[hydroxy-[(2R,3S,5R,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl]oxyphosphoryl]oxymethyl]butanedioic acid (PubChem CID 135852760) has the molecular formula C11H21O19P3 and a molecular weight of 550.19 g/mol. Its IUPAC name is (2S)-2-[[hydroxy-[(2R,3S,5R,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl]oxyphosphoryl]oxymethyl]butanedioic acid.
| Compound Name | (2S)-2-[[hydroxy-[(2R,3S,5R,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl]oxyphosphoryl]oxymethyl]butanedioic acid |
|---|---|
| PubChem CID | 135852760 |
| Molecular Formula | C11H21O19P3 |
| Molecular Weight | 550.19 g/mol |
| Exact Mass | 549.99 |
| IUPAC Name | (2S)-2-[[hydroxy-[(2R,3S,5R,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl]oxyphosphoryl]oxymethyl]butanedioic acid |
| SMILES | O=C(O)C[C@@H](COP(=O)(O)OC1[C@H](O)[C@H](OP(=O)(O)O)C(O)[C@H](OP(=O)(O)O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C11H21O19P3/c12-4(13)1-3(11(17)18)2-27-33(25,26)30-10-6(15)8(28-31(19,20)21)5(14)9(7(10)16)29-32(22,23)24/h3,5-10,14-16H,1-2H2,(H,12,13)(H,17,18)(H,25,26)(H2,19,20,21)(H2,22,23,24)/t3-,5?,6+,7+,8-,9+,10?/m0/s1 |
| InChIKey | GJQVMIMWOYKFHF-SVDZHZODSA-N |
| XLogP | -3.28 |
| TPSA | 324.57 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.19 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|