C25H54O20P4 — CID 10395544
[(2S,3R,5S,6S)-2,6-dihydroxy-3,4,5-triphosphonooxycyclohexyl] [(2S)-2,3-dioctoxypropyl] hydrogen phosphate (PubChem CID 10395544) has the molecular formula C25H54O20P4 and a molecular weight of 798.58 g/mol. Its IUPAC name is [(2S,3R,5S,6S)-2,6-dihydroxy-3,4,5-triphosphonooxycyclohexyl] [(2S)-2,3-dioctoxypropyl] hydrogen phosphate.
| Compound Name | [(2S,3R,5S,6S)-2,6-dihydroxy-3,4,5-triphosphonooxycyclohexyl] [(2S)-2,3-dioctoxypropyl] hydrogen phosphate |
|---|---|
| PubChem CID | 10395544 |
| Molecular Formula | C25H54O20P4 |
| Molecular Weight | 798.58 g/mol |
| Exact Mass | 798.22 |
| IUPAC Name | [(2S,3R,5S,6S)-2,6-dihydroxy-3,4,5-triphosphonooxycyclohexyl] [(2S)-2,3-dioctoxypropyl] hydrogen phosphate |
| SMILES | CCCCCCCCOC[C@@H](COP(=O)(O)OC1[C@H](O)[C@H](OP(=O)(O)O)C(OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H]1O)OCCCCCCCC |
| InChI | InChI=1S/C25H54O20P4/c1-3-5-7-9-11-13-15-39-17-19(40-16-14-12-10-8-6-4-2)18-41-49(37,38)45-22-20(26)23(42-46(28,29)30)25(44-48(34,35)36)24(21(22)27)43-47(31,32)33/h19-27H,3-18H2,1-2H3,(H,37,38)(H2,28,29,30)(H2,31,32,33)(H2,34,35,36)/t19-,20-,21-,22?,23-,24+,25?/m0/s1 |
| InChIKey | YLLZVDOGWQMEMK-VMAURPJHSA-N |
| XLogP | 2.78 |
| TPSA | 314.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|