C25H53NO14P2 — CID 102007253
[(2R)-3-(8-aminooctoxy)-2-octoxypropyl] [(1S,2R,3S,4S,5R,6R)-2,3,4,6-tetrahydroxy-5-phosphonooxycyclohexyl] hydrogen phosphate (PubChem CID 102007253) has the molecular formula C25H53NO14P2 and a molecular weight of 653.64 g/mol. Its IUPAC name is [(2R)-3-(8-aminooctoxy)-2-octoxypropyl] [(1S,2R,3S,4S,5R,6R)-2,3,4,6-tetrahydroxy-5-phosphonooxycyclohexyl] hydrogen phosphate.
| Compound Name | [(2R)-3-(8-aminooctoxy)-2-octoxypropyl] [(1S,2R,3S,4S,5R,6R)-2,3,4,6-tetrahydroxy-5-phosphonooxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 102007253 |
| Molecular Formula | C25H53NO14P2 |
| Molecular Weight | 653.64 g/mol |
| Exact Mass | 653.29 |
| IUPAC Name | [(2R)-3-(8-aminooctoxy)-2-octoxypropyl] [(1S,2R,3S,4S,5R,6R)-2,3,4,6-tetrahydroxy-5-phosphonooxycyclohexyl] hydrogen phosphate |
| SMILES | CCCCCCCCO[C@H](COCCCCCCCCN)COP(=O)(O)O[C@@H]1[C@H](O)[C@H](OP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H53NO14P2/c1-2-3-4-5-10-13-16-37-19(17-36-15-12-9-7-6-8-11-14-26)18-38-42(34,35)40-25-22(29)20(27)21(28)24(23(25)30)39-41(31,32)33/h19-25,27-30H,2-18,26H2,1H3,(H,34,35)(H2,31,32,33)/t19-,20+,21+,22-,23-,24-,25+/m1/s1 |
| InChIKey | DVABRLOPLCJTSH-XCRPLLLMSA-N |
| XLogP | 1.49 |
| TPSA | 247.92 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.64 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|