C33H60NO19P3 — CID 102007257
benzyl N-[8-[(2R)-3-[hydroxy-[(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl]oxyphosphoryl]oxy-2-octoxypropoxy]octyl]carbamate (PubChem CID 102007257) has the molecular formula C33H60NO19P3 and a molecular weight of 867.75 g/mol. Its IUPAC name is benzyl N-[8-[(2R)-3-[hydroxy-[(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl]oxyphosphoryl]oxy-2-octoxypropoxy]octyl]carbamate.
| Compound Name | benzyl N-[8-[(2R)-3-[hydroxy-[(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl]oxyphosphoryl]oxy-2-octoxypropoxy]octyl]carbamate |
|---|---|
| PubChem CID | 102007257 |
| Molecular Formula | C33H60NO19P3 |
| Molecular Weight | 867.75 g/mol |
| Exact Mass | 867.30 |
| IUPAC Name | benzyl N-[8-[(2R)-3-[hydroxy-[(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl]oxyphosphoryl]oxy-2-octoxypropoxy]octyl]carbamate |
| SMILES | CCCCCCCCO[C@H](COCCCCCCCCNC(=O)OCc1ccccc1)COP(=O)(O)OC1[C@H](O)[C@H](OP(=O)(O)O)C(O)[C@H](OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C33H60NO19P3/c1-2-3-4-5-10-16-21-48-26(23-47-20-15-9-7-6-8-14-19-34-33(38)49-22-25-17-12-11-13-18-25)24-50-56(45,46)53-32-28(36)30(51-54(39,40)41)27(35)31(29(32)37)52-55(42,43)44/h11-13,17-18,26-32,35-37H,2-10,14-16,19-24H2,1H3,(H,34,38)(H,45,46)(H2,39,40,41)(H2,42,43,44)/t26-,27?,28-,29-,30-,31+,32?/m1/s1 |
| InChIKey | VYYFDUZTUMMVLZ-ZWGHMDDDSA-N |
| XLogP | 3.57 |
| TPSA | 306.76 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|