C21H47N2O10P — CID 46223660
[(1R,2R,3S,4R,5S,6R)-2-amino-3,4,5,6-tetrahydroxycyclohexyl] [(2S)-2,3-dihexoxypropyl] hydrogen phosphate;azane (PubChem CID 46223660) has the molecular formula C21H47N2O10P and a molecular weight of 518.59 g/mol. Its IUPAC name is [(1R,2R,3S,4R,5S,6R)-2-amino-3,4,5,6-tetrahydroxycyclohexyl] [(2S)-2,3-dihexoxypropyl] hydrogen phosphate;azane.
| Compound Name | [(1R,2R,3S,4R,5S,6R)-2-amino-3,4,5,6-tetrahydroxycyclohexyl] [(2S)-2,3-dihexoxypropyl] hydrogen phosphate;azane |
|---|---|
| PubChem CID | 46223660 |
| Molecular Formula | C21H47N2O10P |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | [(1R,2R,3S,4R,5S,6R)-2-amino-3,4,5,6-tetrahydroxycyclohexyl] [(2S)-2,3-dihexoxypropyl] hydrogen phosphate;azane |
| SMILES | CCCCCCOC[C@@H](COP(=O)(O)O[C@@H]1[C@H](N)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O)OCCCCCC.N |
| InChI | InChI=1S/C21H44NO10P.H3N/c1-3-5-7-9-11-29-13-15(30-12-10-8-6-4-2)14-31-33(27,28)32-21-16(22)17(23)18(24)19(25)20(21)26;/h15-21,23-26H,3-14,22H2,1-2H3,(H,27,28);1H3/t15-,16+,17-,18+,19-,20+,21+;/m0./s1 |
| InChIKey | HFXXJZSGPUTAHG-NKHVIGBCSA-N |
| XLogP | 1.00 |
| TPSA | 216.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|