C25H54NO17P3 — CID 102007259
[(2R)-3-(8-aminooctoxy)-2-octoxypropyl] [(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate (PubChem CID 102007259) has the molecular formula C25H54NO17P3 and a molecular weight of 733.62 g/mol. Its IUPAC name is [(2R)-3-(8-aminooctoxy)-2-octoxypropyl] [(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate.
| Compound Name | [(2R)-3-(8-aminooctoxy)-2-octoxypropyl] [(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 102007259 |
| Molecular Formula | C25H54NO17P3 |
| Molecular Weight | 733.62 g/mol |
| Exact Mass | 733.26 |
| IUPAC Name | [(2R)-3-(8-aminooctoxy)-2-octoxypropyl] [(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate |
| SMILES | CCCCCCCCO[C@H](COCCCCCCCCN)COP(=O)(O)OC1[C@H](O)[C@H](OP(=O)(O)O)C(O)[C@H](OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C25H54NO17P3/c1-2-3-4-5-10-13-16-39-19(17-38-15-12-9-7-6-8-11-14-26)18-40-46(36,37)43-25-21(28)23(41-44(30,31)32)20(27)24(22(25)29)42-45(33,34)35/h19-25,27-29H,2-18,26H2,1H3,(H,36,37)(H2,30,31,32)(H2,33,34,35)/t19-,20?,21-,22-,23-,24+,25?/m1/s1 |
| InChIKey | ACMBWUHAKNNKOJ-QBHYXXGNSA-N |
| XLogP | 1.60 |
| TPSA | 294.45 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.62 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|