C23H49O6P — CID 87439612
2,3-didecoxypropyl dihydrogen phosphate (PubChem CID 87439612) has the molecular formula C23H49O6P and a molecular weight of 452.61 g/mol. Its IUPAC name is 2,3-didecoxypropyl dihydrogen phosphate.
| Compound Name | 2,3-didecoxypropyl dihydrogen phosphate |
|---|---|
| PubChem CID | 87439612 |
| Molecular Formula | C23H49O6P |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | 2,3-didecoxypropyl dihydrogen phosphate |
| SMILES | CCCCCCCCCCOCC(COP(=O)(O)O)OCCCCCCCCCC |
| InChI | InChI=1S/C23H49O6P/c1-3-5-7-9-11-13-15-17-19-27-21-23(22-29-30(24,25)26)28-20-18-16-14-12-10-8-6-4-2/h23H,3-22H2,1-2H3,(H2,24,25,26) |
| InChIKey | OAOIUJGQYOYBTB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|