C27H47O11P — CID 10348190
[(2R)-2,3-dihexoxypropyl] [(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] phenyl phosphate (PubChem CID 10348190) has the molecular formula C27H47O11P and a molecular weight of 578.64 g/mol. Its IUPAC name is [(2R)-2,3-dihexoxypropyl] [(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] phenyl phosphate.
| Compound Name | [(2R)-2,3-dihexoxypropyl] [(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] phenyl phosphate |
|---|---|
| PubChem CID | 10348190 |
| Molecular Formula | C27H47O11P |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | [(2R)-2,3-dihexoxypropyl] [(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] phenyl phosphate |
| SMILES | CCCCCCOC[C@H](COP(=O)(Oc1ccccc1)OC1[C@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O)OCCCCCC |
| InChI | InChI=1S/C27H47O11P/c1-3-5-7-12-16-34-18-21(35-17-13-8-6-4-2)19-36-39(33,37-20-14-10-9-11-15-20)38-27-25(31)23(29)22(28)24(30)26(27)32/h9-11,14-15,21-32H,3-8,12-13,16-19H2,1-2H3/t21-,22?,23-,24+,25-,26-,27?,39?/m1/s1 |
| InChIKey | NOEOEMHUBFZJIE-KDVHOMNJSA-N |
| XLogP | 2.96 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|