C14H31O17P3 — CID 87697892
[(2S)-1-hydroxy-3-pentoxypropan-2-yl] (2,3,6-trihydroxy-4,5-diphosphonooxycyclohexyl) hydrogen phosphate (PubChem CID 87697892) has the molecular formula C14H31O17P3 and a molecular weight of 564.31 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-pentoxypropan-2-yl] (2,3,6-trihydroxy-4,5-diphosphonooxycyclohexyl) hydrogen phosphate.
| Compound Name | [(2S)-1-hydroxy-3-pentoxypropan-2-yl] (2,3,6-trihydroxy-4,5-diphosphonooxycyclohexyl) hydrogen phosphate |
|---|---|
| PubChem CID | 87697892 |
| Molecular Formula | C14H31O17P3 |
| Molecular Weight | 564.31 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | [(2S)-1-hydroxy-3-pentoxypropan-2-yl] (2,3,6-trihydroxy-4,5-diphosphonooxycyclohexyl) hydrogen phosphate |
| SMILES | CCCCCOC[C@H](CO)OP(=O)(O)OC1C(O)C(O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1O |
| InChI | InChI=1S/C14H31O17P3/c1-2-3-4-5-27-7-8(6-15)28-34(25,26)31-12-9(16)10(17)13(29-32(19,20)21)14(11(12)18)30-33(22,23)24/h8-18H,2-7H2,1H3,(H,25,26)(H2,19,20,21)(H2,22,23,24)/t8-,9?,10?,11?,12?,13?,14?/m0/s1 |
| InChIKey | WHYMOZHBYVETJS-JISXRMOGSA-N |
| XLogP | -1.89 |
| TPSA | 279.43 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.31 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|