C9H19O10P — CID 102506295
[(2S)-2-hydroxypropyl] [(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate (PubChem CID 102506295) has the molecular formula C9H19O10P and a molecular weight of 318.22 g/mol. Its IUPAC name is [(2S)-2-hydroxypropyl] [(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate.
| Compound Name | [(2S)-2-hydroxypropyl] [(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 102506295 |
| Molecular Formula | C9H19O10P |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [(2S)-2-hydroxypropyl] [(2R,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] hydrogen phosphate |
| SMILES | C[C@H](O)COP(=O)(O)OC1[C@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H19O10P/c1-3(10)2-18-20(16,17)19-9-7(14)5(12)4(11)6(13)8(9)15/h3-15H,2H2,1H3,(H,16,17)/t3-,4?,5-,6+,7+,8+,9?/m0/s1 |
| InChIKey | RWZRMLYARYCZJA-JOKWFQEDSA-N |
| XLogP | -3.31 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|