C11H19O13P — CID 73317041
[2-formyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] formate (PubChem CID 73317041) has the molecular formula C11H19O13P and a molecular weight of 390.23 g/mol. Its IUPAC name is [2-formyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] formate.
| Compound Name | [2-formyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] formate |
|---|---|
| PubChem CID | 73317041 |
| Molecular Formula | C11H19O13P |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | [2-formyloxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] formate |
| SMILES | O=COCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC=O |
| InChI | InChI=1S/C11H19O13P/c12-3-21-1-5(22-4-13)2-23-25(19,20)24-11-9(17)7(15)6(14)8(16)10(11)18/h3-11,14-18H,1-2H2,(H,19,20) |
| InChIKey | GUBXYMKIJFOYOA-UHFFFAOYSA-N |
| XLogP | -3.98 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|