C18H31N4O13P — CID 89383220
[2-formyloxy-3-[hydroxy-[2-[[2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetyl]amino]ethoxy]phosphoryl]oxypropyl] formate (PubChem CID 89383220) has the molecular formula C18H31N4O13P and a molecular weight of 542.44 g/mol. Its IUPAC name is [2-formyloxy-3-[hydroxy-[2-[[2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetyl]amino]ethoxy]phosphoryl]oxypropyl] formate.
| Compound Name | [2-formyloxy-3-[hydroxy-[2-[[2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetyl]amino]ethoxy]phosphoryl]oxypropyl] formate |
|---|---|
| PubChem CID | 89383220 |
| Molecular Formula | C18H31N4O13P |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | [2-formyloxy-3-[hydroxy-[2-[[2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetyl]amino]ethoxy]phosphoryl]oxypropyl] formate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(=O)NCC(=O)NCCOP(=O)(O)OCC(COC=O)OC=O |
| InChI | InChI=1S/C18H31N4O13P/c1-18(2,3)35-17(28)22-8-16(27)21-7-15(26)20-6-14(25)19-4-5-33-36(29,30)34-10-13(32-12-24)9-31-11-23/h11-13H,4-10H2,1-3H3,(H,19,25)(H,20,26)(H,21,27)(H,22,28)(H,29,30) |
| InChIKey | JGCXPCWQFPYHIU-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 233.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|