C13H22O17P2 — CID 74409370
[3-[[3-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-formyloxypropyl] formate (PubChem CID 74409370) has the molecular formula C13H22O17P2 and a molecular weight of 512.25 g/mol. Its IUPAC name is [3-[[3-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-formyloxypropyl] formate.
| Compound Name | [3-[[3-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-formyloxypropyl] formate |
|---|---|
| PubChem CID | 74409370 |
| Molecular Formula | C13H22O17P2 |
| Molecular Weight | 512.25 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | [3-[[3-[2,3-diformyloxypropoxy(hydroxy)phosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-formyloxypropyl] formate |
| SMILES | O=COCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC=O)OC=O)OC=O |
| InChI | InChI=1S/C13H22O17P2/c14-7-23-3-12(25-9-16)5-29-31(19,20)27-1-11(18)2-28-32(21,22)30-6-13(26-10-17)4-24-8-15/h7-13,18H,1-6H2,(H,19,20)(H,21,22) |
| InChIKey | VCGDSYLTBQKCQN-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 236.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.25 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|