C8H17O9P — CID 153447851
[(2R)-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] acetate (PubChem CID 153447851) has the molecular formula C8H17O9P and a molecular weight of 288.19 g/mol. Its IUPAC name is [(2R)-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] acetate.
| Compound Name | [(2R)-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] acetate |
|---|---|
| PubChem CID | 153447851 |
| Molecular Formula | C8H17O9P |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | [(2R)-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] acetate |
| SMILES | CC(=O)OC[C@@H](O)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C8H17O9P/c1-6(10)15-3-8(12)5-17-18(13,14)16-4-7(11)2-9/h7-9,11-12H,2-5H2,1H3,(H,13,14)/t7?,8-/m1/s1 |
| InChIKey | TVDNPYDRVKWCQW-BRFYHDHCSA-N |
| XLogP | -1.60 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|