C18H35O10P — CID 138226910
[1-acetyloxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] decanoate (PubChem CID 138226910) has the molecular formula C18H35O10P and a molecular weight of 442.44 g/mol. Its IUPAC name is [1-acetyloxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] decanoate.
| Compound Name | [1-acetyloxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] decanoate |
|---|---|
| PubChem CID | 138226910 |
| Molecular Formula | C18H35O10P |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [1-acetyloxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(COC(C)=O)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C18H35O10P/c1-3-4-5-6-7-8-9-10-18(22)28-17(13-25-15(2)20)14-27-29(23,24)26-12-16(21)11-19/h16-17,19,21H,3-14H2,1-2H3,(H,23,24) |
| InChIKey | OHARXCQUUAUREN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|