C7H13O7P — CID 89188019
[3-[ethenoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] acetate (PubChem CID 89188019) has the molecular formula C7H13O7P and a molecular weight of 240.15 g/mol. Its IUPAC name is [3-[ethenoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] acetate.
| Compound Name | [3-[ethenoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] acetate |
|---|---|
| PubChem CID | 89188019 |
| Molecular Formula | C7H13O7P |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | [3-[ethenoxy(hydroxy)phosphoryl]oxy-2-hydroxypropyl] acetate |
| SMILES | C=COP(=O)(O)OCC(O)COC(C)=O |
| InChI | InChI=1S/C7H13O7P/c1-3-13-15(10,11)14-5-7(9)4-12-6(2)8/h3,7,9H,1,4-5H2,2H3,(H,10,11) |
| InChIKey | UDWFCYVCNJBJRY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|