C10H21O7P — CID 90700540
[2-hydroxy-3-[hydroxy(propan-2-yloxy)phosphoryl]oxypropyl] 2-methylpropanoate (PubChem CID 90700540) has the molecular formula C10H21O7P and a molecular weight of 284.25 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy(propan-2-yloxy)phosphoryl]oxypropyl] 2-methylpropanoate.
| Compound Name | [2-hydroxy-3-[hydroxy(propan-2-yloxy)phosphoryl]oxypropyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 90700540 |
| Molecular Formula | C10H21O7P |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | [2-hydroxy-3-[hydroxy(propan-2-yloxy)phosphoryl]oxypropyl] 2-methylpropanoate |
| SMILES | CC(C)OP(=O)(O)OCC(O)COC(=O)C(C)C |
| InChI | InChI=1S/C10H21O7P/c1-7(2)10(12)15-5-9(11)6-16-18(13,14)17-8(3)4/h7-9,11H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | COHGOBYOCPSYOD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|